About 2,3-dimethoxypropanal
2,3-dimethoxypropanal (PubChem CID 12962854) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is 2,3-dimethoxypropanal.
Molecular Properties
| Compound Name | 2,3-dimethoxypropanal |
| PubChem CID | 12962854 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | 2,3-dimethoxypropanal |
| SMILES | COCC(C=O)OC |
| InChI | InChI=1S/C5H10O3/c1-7-4-5(3-6)8-2/h3,5H,4H2,1-2H3 |
| InChIKey | PNENILZGBBXDAG-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethoxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxypropanal?
The IUPAC name of 2,3-dimethoxypropanal (CID 12962854) is 2,3-dimethoxypropanal.
What is the SMILES notation for 2,3-dimethoxypropanal?
The canonical SMILES for 2,3-dimethoxypropanal is COCC(C=O)OC.
What is the InChIKey of 2,3-dimethoxypropanal?
The InChIKey is PNENILZGBBXDAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3/c1-7-4-5(3-6)8-2/h3,5H,4H2,1-2H3.
What are the key properties of 2,3-dimethoxypropanal?
2,3-dimethoxypropanal has a molecular weight of 118.13 g/mol, XLogP of -0.15, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxypropanal is sourced from PubChem (CID 12962854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).