About 2-methylpenta-2,3-dien-1-ol
2-methylpenta-2,3-dien-1-ol (PubChem CID 12962864) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is 2-methylpenta-2,3-dien-1-ol.
Molecular Properties
| Compound Name | 2-methylpenta-2,3-dien-1-ol |
| PubChem CID | 12962864 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | 2-methylpenta-2,3-dien-1-ol |
| SMILES | CC=C=C(C)CO |
| InChI | InChI=1S/C6H10O/c1-3-4-6(2)5-7/h3,7H,5H2,1-2H3 |
| InChIKey | JPXXAGXWHQPZFS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpenta-2,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpenta-2,3-dien-1-ol?
The IUPAC name of 2-methylpenta-2,3-dien-1-ol (CID 12962864) is 2-methylpenta-2,3-dien-1-ol.
What is the SMILES notation for 2-methylpenta-2,3-dien-1-ol?
The canonical SMILES for 2-methylpenta-2,3-dien-1-ol is CC=C=C(C)CO.
What is the InChIKey of 2-methylpenta-2,3-dien-1-ol?
The InChIKey is JPXXAGXWHQPZFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O/c1-3-4-6(2)5-7/h3,7H,5H2,1-2H3.
What are the key properties of 2-methylpenta-2,3-dien-1-ol?
2-methylpenta-2,3-dien-1-ol has a molecular weight of 98.14 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpenta-2,3-dien-1-ol is sourced from PubChem (CID 12962864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).