About 1-sulfanyldecan-2-ol
1-sulfanyldecan-2-ol (PubChem CID 12963327) has the molecular formula C10H22OS
and a molecular weight of 190.35 g/mol. Its IUPAC name is 1-sulfanyldecan-2-ol.
Molecular Properties
| Compound Name | 1-sulfanyldecan-2-ol |
| PubChem CID | 12963327 |
| Molecular Formula | C10H22OS |
| Molecular Weight | 190.35 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-sulfanyldecan-2-ol |
| SMILES | CCCCCCCCC(O)CS |
| InChI | InChI=1S/C10H22OS/c1-2-3-4-5-6-7-8-10(11)9-12/h10-12H,2-9H2,1H3 |
| InChIKey | YXHLDPGSHVXBRB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfanyldecan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfanyldecan-2-ol?
The IUPAC name of 1-sulfanyldecan-2-ol (CID 12963327) is 1-sulfanyldecan-2-ol.
What is the SMILES notation for 1-sulfanyldecan-2-ol?
The canonical SMILES for 1-sulfanyldecan-2-ol is CCCCCCCCC(O)CS.
What is the InChIKey of 1-sulfanyldecan-2-ol?
The InChIKey is YXHLDPGSHVXBRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22OS/c1-2-3-4-5-6-7-8-10(11)9-12/h10-12H,2-9H2,1H3.
What are the key properties of 1-sulfanyldecan-2-ol?
1-sulfanyldecan-2-ol has a molecular weight of 190.35 g/mol, XLogP of 3.03, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfanyldecan-2-ol is sourced from PubChem (CID 12963327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).