About N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide
N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide (PubChem CID 12964007) has the molecular formula C16H21NO3
and a molecular weight of 275.35 g/mol. Its IUPAC name is N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide.
Molecular Properties
| Compound Name | N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide |
| PubChem CID | 12964007 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide |
| SMILES | [O-]/[N+](=C\[C@H]1COC2(CCCCC2)O1)Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c18-17(11-14-7-3-1-4-8-14)12-15-13-19-16(20-15)9-5-2-6-10-16/h1,3-4,7-8,12,15H,2,5-6,9-11,13H2/b17-12-/t15-/m0/s1 |
| InChIKey | NLDSZKYXHQCKPU-ZKMNFCBKSA-N |
| XLogP | 2.84 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide?
The IUPAC name of N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide (CID 12964007) is N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide.
What is the SMILES notation for N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide?
The canonical SMILES for N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide is [O-]/[N+](=C\[C@H]1COC2(CCCCC2)O1)Cc1ccccc1.
What is the InChIKey of N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide?
The InChIKey is NLDSZKYXHQCKPU-ZKMNFCBKSA-N. The full InChI is InChI=1S/C16H21NO3/c18-17(11-14-7-3-1-4-8-14)12-15-13-19-16(20-15)9-5-2-6-10-16/h1,3-4,7-8,12,15H,2,5-6,9-11,13H2/b17-12-/t15-/m0/s1.
What are the key properties of N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide?
N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide has a molecular weight of 275.35 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanimine oxide is sourced from PubChem (CID 12964007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).