C25H27N3O4 — CID 12964025
ethyl 2-(4-benzyl-17-methyl-15-oxo-7-oxa-4,14,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16)-tetraen-6-yl)acetate (PubChem CID 12964025) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is ethyl 2-(4-benzyl-17-methyl-15-oxo-7-oxa-4,14,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16)-tetraen-6-yl)acetate.
| Compound Name | ethyl 2-(4-benzyl-17-methyl-15-oxo-7-oxa-4,14,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16)-tetraen-6-yl)acetate |
|---|---|
| PubChem CID | 12964025 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | ethyl 2-(4-benzyl-17-methyl-15-oxo-7-oxa-4,14,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16)-tetraen-6-yl)acetate |
| SMILES | CCOC(=O)CC1CN(Cc2ccccc2)c2cc3c(cc2O1)c1c(n3C)C(=O)NCC1 |
| InChI | InChI=1S/C25H27N3O4/c1-3-31-23(29)11-17-15-28(14-16-7-5-4-6-8-16)21-13-20-19(12-22(21)32-17)18-9-10-26-25(30)24(18)27(20)2/h4-8,12-13,17H,3,9-11,14-15H2,1-2H3,(H,26,30) |
| InChIKey | BRQWFBJXZWXRRY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|