C30H34 — CID 12964189
[3-butyl-4,5-dimethylidene-6-(2-phenylethynyl)dec-1-ynyl]benzene (PubChem CID 12964189) has the molecular formula C30H34 and a molecular weight of 394.60 g/mol. Its IUPAC name is [3-butyl-4,5-dimethylidene-6-(2-phenylethynyl)dec-1-ynyl]benzene.
| Compound Name | [3-butyl-4,5-dimethylidene-6-(2-phenylethynyl)dec-1-ynyl]benzene |
|---|---|
| PubChem CID | 12964189 |
| Molecular Formula | C30H34 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | [3-butyl-4,5-dimethylidene-6-(2-phenylethynyl)dec-1-ynyl]benzene |
| SMILES | C=C(C(=C)C(C#Cc1ccccc1)CCCC)C(C#Cc1ccccc1)CCCC |
| InChI | InChI=1S/C30H34/c1-5-7-19-29(23-21-27-15-11-9-12-16-27)25(3)26(4)30(20-8-6-2)24-22-28-17-13-10-14-18-28/h9-18,29-30H,3-8,19-20H2,1-2H3 |
| InChIKey | KMLLFZHLUAZEEW-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|