About 3,7-dimethyloct-6-enyl 2-oxopropanoate
3,7-dimethyloct-6-enyl 2-oxopropanoate (PubChem CID 12965181) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 2-oxopropanoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl 2-oxopropanoate |
| PubChem CID | 12965181 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C13H22O3/c1-10(2)6-5-7-11(3)8-9-16-13(15)12(4)14/h6,11H,5,7-9H2,1-4H3 |
| InChIKey | PLCACGAOUFEMJS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl 2-oxopropanoate?
The IUPAC name of 3,7-dimethyloct-6-enyl 2-oxopropanoate (CID 12965181) is 3,7-dimethyloct-6-enyl 2-oxopropanoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl 2-oxopropanoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl 2-oxopropanoate is CC(=O)C(=O)OCCC(C)CCC=C(C)C.
What is the InChIKey of 3,7-dimethyloct-6-enyl 2-oxopropanoate?
The InChIKey is PLCACGAOUFEMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-10(2)6-5-7-11(3)8-9-16-13(15)12(4)14/h6,11H,5,7-9H2,1-4H3.
What are the key properties of 3,7-dimethyloct-6-enyl 2-oxopropanoate?
3,7-dimethyloct-6-enyl 2-oxopropanoate has a molecular weight of 226.32 g/mol, XLogP of 2.89, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl 2-oxopropanoate is sourced from PubChem (CID 12965181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).