About Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester
Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester (PubChem CID 129658823) has the molecular formula C24H44O4
and a molecular weight of 396.60 g/mol. Its IUPAC name is 9-O-(2,2-dimethylpentyl) 1-O-[(1-methylcyclohexyl)methyl] nonanedioate.
Molecular Properties
| Compound Name | Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester |
| PubChem CID | 129658823 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | 9-O-(2,2-dimethylpentyl) 1-O-[(1-methylcyclohexyl)methyl] nonanedioate |
| SMILES | CCCC(C)(C)COC(=O)CCCCCCCC(=O)OCC1(CCCCC1)C |
| InChI | InChI=1S/C24H44O4/c1-5-16-23(2,3)19-27-21(25)14-10-7-6-8-11-15-22(26)28-20-24(4)17-12-9-13-18-24/h5-20H2,1-4H3 |
| InChIKey | WROBOMFKPFXTOT-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | 450 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester?
The IUPAC name of Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester (CID 129658823) is 9-O-(2,2-dimethylpentyl) 1-O-[(1-methylcyclohexyl)methyl] nonanedioate.
What is the SMILES notation for Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester?
The canonical SMILES for Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester is CCCC(C)(C)COC(=O)CCCCCCCC(=O)OCC1(CCCCC1)C.
What is the InChIKey of Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester?
The InChIKey is WROBOMFKPFXTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O4/c1-5-16-23(2,3)19-27-21(25)14-10-7-6-8-11-15-22(26)28-20-24(4)17-12-9-13-18-24/h5-20H2,1-4H3.
What are the key properties of Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester?
Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester has a molecular weight of 396.60 g/mol, XLogP of 7.60, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Nonanedioic acid 2,2-dimethylpentyl ester 1-methylcyclohexylmethyl ester is sourced from PubChem (CID 129658823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).