C50H56N2SSi2 — CID 12966090
2-[4-[(E)-4-(2-thiophen-2-ylethynyl)-6-tri(propan-2-yl)silyl-3-[2-tri(propan-2-yl)silylethynyl]hex-3-en-1,5-diynyl]phenyl]-8aH-azulene-1,1-dicarbonitrile (PubChem CID 12966090) has the molecular formula C50H56N2SSi2 and a molecular weight of 773.25 g/mol. Its IUPAC name is 2-[4-[(E)-4-(2-thiophen-2-ylethynyl)-6-tri(propan-2-yl)silyl-3-[2-tri(propan-2-yl)silylethynyl]hex-3-en-1,5-diynyl]phenyl]-8aH-azulene-1,1-dicarbonitrile.
| Compound Name | 2-[4-[(E)-4-(2-thiophen-2-ylethynyl)-6-tri(propan-2-yl)silyl-3-[2-tri(propan-2-yl)silylethynyl]hex-3-en-1,5-diynyl]phenyl]-8aH-azulene-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 12966090 |
| Molecular Formula | C50H56N2SSi2 |
| Molecular Weight | 773.25 g/mol |
| Exact Mass | 772.37 |
| IUPAC Name | 2-[4-[(E)-4-(2-thiophen-2-ylethynyl)-6-tri(propan-2-yl)silyl-3-[2-tri(propan-2-yl)silylethynyl]hex-3-en-1,5-diynyl]phenyl]-8aH-azulene-1,1-dicarbonitrile |
| SMILES | CC(C)[Si](C#C/C(C#Cc1ccc(C2=CC3=CC=CC=CC3C2(C#N)C#N)cc1)=C(\C#Cc1cccs1)C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C50H56N2SSi2/c1-36(2)54(37(3)4,38(5)6)31-28-43(44(26-27-47-18-16-30-53-47)29-32-55(39(7)8,40(9)10)41(11)12)23-20-42-21-24-45(25-22-42)49-33-46-17-14-13-15-19-48(46)50(49,34-51)35-52/h13-19,21-22,24-25,30,33,36-41,48H,1-12H3/b44-43+ |
| InChIKey | ALQYPSRYJGVOEN-VGFSZAGXSA-N |
| XLogP | 12.99 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.25 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|