C27H46O5Si — CID 12966277
diethyl (3aS,7aR)-6,6-dimethyl-3-methylidene-4-tri(propan-2-yl)silyloxy-2,3a,7,7a-tetrahydroindene-1,1-dicarboxylate (PubChem CID 12966277) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is diethyl (3aS,7aR)-6,6-dimethyl-3-methylidene-4-tri(propan-2-yl)silyloxy-2,3a,7,7a-tetrahydroindene-1,1-dicarboxylate.
| Compound Name | diethyl (3aS,7aR)-6,6-dimethyl-3-methylidene-4-tri(propan-2-yl)silyloxy-2,3a,7,7a-tetrahydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 12966277 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | diethyl (3aS,7aR)-6,6-dimethyl-3-methylidene-4-tri(propan-2-yl)silyloxy-2,3a,7,7a-tetrahydroindene-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)[C@@H]2CC(C)(C)C=C(O[Si](C(C)C)(C(C)C)C(C)C)[C@H]12 |
| InChI | InChI=1S/C27H46O5Si/c1-12-30-24(28)27(25(29)31-13-2)14-20(9)23-21(27)15-26(10,11)16-22(23)32-33(17(3)4,18(5)6)19(7)8/h16-19,21,23H,9,12-15H2,1-8,10-11H3/t21-,23-/m1/s1 |
| InChIKey | PPTHIICMJBWYTE-FYYLOGMGSA-N |
| XLogP | 6.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|