C27H46O5Si — CID 12966278
diethyl (4aR,8aR)-7,7-dimethyl-5-tri(propan-2-yl)silyloxy-2,4a,8,8a-tetrahydronaphthalene-1,1-dicarboxylate (PubChem CID 12966278) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is diethyl (4aR,8aR)-7,7-dimethyl-5-tri(propan-2-yl)silyloxy-2,4a,8,8a-tetrahydronaphthalene-1,1-dicarboxylate.
| Compound Name | diethyl (4aR,8aR)-7,7-dimethyl-5-tri(propan-2-yl)silyloxy-2,4a,8,8a-tetrahydronaphthalene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 12966278 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | diethyl (4aR,8aR)-7,7-dimethyl-5-tri(propan-2-yl)silyloxy-2,4a,8,8a-tetrahydronaphthalene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC=C[C@H]2C(O[Si](C(C)C)(C(C)C)C(C)C)=CC(C)(C)C[C@H]21 |
| InChI | InChI=1S/C27H46O5Si/c1-11-30-24(28)27(25(29)31-12-2)15-13-14-21-22(27)16-26(9,10)17-23(21)32-33(18(3)4,19(5)6)20(7)8/h13-14,17-22H,11-12,15-16H2,1-10H3/t21-,22-/m1/s1 |
| InChIKey | GDCVSNVQHWHFLX-FGZHOGPDSA-N |
| XLogP | 6.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|