About 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine
2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine (PubChem CID 12966419) has the molecular formula C20H16N4S2
and a molecular weight of 376.51 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine |
| PubChem CID | 12966419 |
| Molecular Formula | C20H16N4S2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine |
| SMILES | Nc1c(C2=NCCN2)sc2nc(-c3cccs3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H16N4S2/c21-17-16-13(12-5-2-1-3-6-12)11-14(15-7-4-10-25-15)24-20(16)26-18(17)19-22-8-9-23-19/h1-7,10-11H,8-9,21H2,(H,22,23) |
| InChIKey | UJLSFKZUTWRQSD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine (CID 12966419) is 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine is Nc1c(C2=NCCN2)sc2nc(-c3cccs3)cc(-c3ccccc3)c12.
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine?
The InChIKey is UJLSFKZUTWRQSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4S2/c21-17-16-13(12-5-2-1-3-6-12)11-14(15-7-4-10-25-15)24-20(16)26-18(17)19-22-8-9-23-19/h1-7,10-11H,8-9,21H2,(H,22,23).
What are the key properties of 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine?
2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine has a molecular weight of 376.51 g/mol, XLogP of 4.62, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-2-yl)-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine is sourced from PubChem (CID 12966419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).