C21H29NO2 — CID 12966636
(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-[(E)-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine-2-carbaldehyde (PubChem CID 12966636) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-4,4,7-trimethyl-3-[(E)-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine-2-carbaldehyde.
| Compound Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-3-[(E)-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine-2-carbaldehyde |
|---|---|
| PubChem CID | 12966636 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (2S,4aS,7R,8aR)-4,4,7-trimethyl-3-[(E)-3-phenylprop-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine-2-carbaldehyde |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C=O)N(C/C=C/c1ccccc1)C2(C)C |
| InChI | InChI=1S/C21H29NO2/c1-16-11-12-18-19(14-16)24-20(15-23)22(21(18,2)3)13-7-10-17-8-5-4-6-9-17/h4-10,15-16,18-20H,11-14H2,1-3H3/b10-7+/t16-,18-,19-,20+/m1/s1 |
| InChIKey | CIRQUOXPHSXGBW-PCDLTAKESA-N |
| XLogP | 4.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|