C17H24O6 — CID 12966871
trans-methyl (1S,2S)-2-[3-acetyloxy-2-(acetyloxymethyl)prop-1-enyl]-6-methylidenecyclohexane-1-carboxylate (PubChem CID 12966871) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-[3-acetyloxy-2-(acetyloxymethyl)prop-1-enyl]-6-methylidenecyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-[3-acetyloxy-2-(acetyloxymethyl)prop-1-enyl]-6-methylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 12966871 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | trans-methyl (1S,2S)-2-[3-acetyloxy-2-(acetyloxymethyl)prop-1-enyl]-6-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1CCC[C@@H](C=C(COC(C)=O)COC(C)=O)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C17H24O6/c1-11-6-5-7-15(16(11)17(20)21-4)8-14(9-22-12(2)18)10-23-13(3)19/h8,15-16H,1,5-7,9-10H2,2-4H3/t15-,16+/m0/s1 |
| InChIKey | VHZNDGXDLAXRPD-JKSUJKDBSA-N |
| XLogP | 2.18 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|