About 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate
1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate (PubChem CID 12966913) has the molecular formula C10H20F3N5O3S
and a molecular weight of 347.36 g/mol. Its IUPAC name is 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate |
| PubChem CID | 12966913 |
| Molecular Formula | C10H20F3N5O3S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate |
| SMILES | CN1CC[N+](C)(CCCN=[N+]=[N-])CC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H20N5.CHF3O3S/c1-13-5-8-14(2,9-6-13)7-3-4-11-12-10;2-1(3,4)8(5,6)7/h3-9H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | YOKGDRMAQIBCIA-UHFFFAOYSA-M |
| XLogP | 1.13 |
| TPSA | 109.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate?
The IUPAC name of 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate (CID 12966913) is 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate.
What is the SMILES notation for 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate?
The canonical SMILES for 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate is CN1CC[N+](C)(CCCN=[N+]=[N-])CC1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate?
The InChIKey is YOKGDRMAQIBCIA-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H20N5.CHF3O3S/c1-13-5-8-14(2,9-6-13)7-3-4-11-12-10;2-1(3,4)8(5,6)7/h3-9H2,1-2H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate?
1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate has a molecular weight of 347.36 g/mol, XLogP of 1.13, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium;trifluoromethanesulfonate is sourced from PubChem (CID 12966913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).