About 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium
1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium (PubChem CID 12966914) has the molecular formula C9H20N5+
and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium.
Molecular Properties
| Compound Name | 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium |
| PubChem CID | 12966914 |
| Molecular Formula | C9H20N5+ |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium |
| SMILES | CN1CC[N+](C)(CCCN=[N+]=[N-])CC1 |
| InChI | InChI=1S/C9H20N5/c1-13-5-8-14(2,9-6-13)7-3-4-11-12-10/h3-9H2,1-2H3/q+1 |
| InChIKey | MXZJYPYYKRSJOQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium?
The IUPAC name of 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium (CID 12966914) is 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium.
What is the SMILES notation for 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium?
The canonical SMILES for 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium is CN1CC[N+](C)(CCCN=[N+]=[N-])CC1.
What is the InChIKey of 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium?
The InChIKey is MXZJYPYYKRSJOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N5/c1-13-5-8-14(2,9-6-13)7-3-4-11-12-10/h3-9H2,1-2H3/q+1.
What are the key properties of 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium?
1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium has a molecular weight of 198.29 g/mol, XLogP of 1.08, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-azidopropyl)-1,4-dimethylpiperazin-1-ium is sourced from PubChem (CID 12966914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).