C22H38O5 — CID 12966958
(3aR,4R,5R,6aS)-4-[(E,3S)-3-(oxan-2-yloxy)dec-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 12966958) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E,3S)-3-(oxan-2-yloxy)dec-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E,3S)-3-(oxan-2-yloxy)dec-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 12966958 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E,3S)-3-(oxan-2-yloxy)dec-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | CCCCCCC[C@@H](/C=C/[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1O)OC1CCCCO1 |
| InChI | InChI=1S/C22H38O5/c1-2-3-4-5-6-9-16(26-22-10-7-8-13-25-22)11-12-17-18-14-21(24)27-20(18)15-19(17)23/h11-12,16-24H,2-10,13-15H2,1H3/b12-11+/t16-,17+,18+,19+,20-,21?,22?/m0/s1 |
| InChIKey | HIYROCCEXXVQTF-BHSKYLNGSA-N |
| XLogP | 3.92 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|