About 4-Lutidyllithium
4-Lutidyllithium (PubChem CID 129669650) has the molecular formula C7H8LiN
and a molecular weight of 113.10 g/mol. Its IUPAC name is lithium 2,6-dimethyl-4H-pyridin-4-ide.
Molecular Properties
| Compound Name | 4-Lutidyllithium |
| PubChem CID | 129669650 |
| Molecular Formula | C7H8LiN |
| Molecular Weight | 113.10 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | lithium 2,6-dimethyl-4H-pyridin-4-ide |
| SMILES | [Li+].CC1=NC(=C[C-]=C1)C |
| InChI | InChI=1S/C7H8N.Li/c1-6-4-3-5-7(2)8-6;/h4-5H,1-2H3;/q-1;+1 |
| InChIKey | YOVNOUZVTUVJBX-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 158 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-Lutidyllithium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Lutidyllithium?
The IUPAC name of 4-Lutidyllithium (CID 129669650) is lithium 2,6-dimethyl-4H-pyridin-4-ide.
What is the SMILES notation for 4-Lutidyllithium?
The canonical SMILES for 4-Lutidyllithium is [Li+].CC1=NC(=C[C-]=C1)C.
What is the InChIKey of 4-Lutidyllithium?
The InChIKey is YOVNOUZVTUVJBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N.Li/c1-6-4-3-5-7(2)8-6;/h4-5H,1-2H3;/q-1;+1.
What are the key properties of 4-Lutidyllithium?
4-Lutidyllithium has a molecular weight of 113.10 g/mol, XLogP of not available, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Lutidyllithium is sourced from PubChem (CID 129669650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).