About 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol
2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol (PubChem CID 12967236) has the molecular formula C17H25BrO3
and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol.
Molecular Properties
| Compound Name | 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol |
| PubChem CID | 12967236 |
| Molecular Formula | C17H25BrO3 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol |
| SMILES | COc1cc(C2OCC(C)(C)C2(O)C(C)(C)C)ccc1Br |
| InChI | InChI=1S/C17H25BrO3/c1-15(2,3)17(19)14(21-10-16(17,4)5)11-7-8-12(18)13(9-11)20-6/h7-9,14,19H,10H2,1-6H3 |
| InChIKey | QLEOBGFAOGZQDG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol?
The IUPAC name of 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol (CID 12967236) is 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol.
What is the SMILES notation for 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol?
The canonical SMILES for 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol is COc1cc(C2OCC(C)(C)C2(O)C(C)(C)C)ccc1Br.
What is the InChIKey of 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol?
The InChIKey is QLEOBGFAOGZQDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25BrO3/c1-15(2,3)17(19)14(21-10-16(17,4)5)11-7-8-12(18)13(9-11)20-6/h7-9,14,19H,10H2,1-6H3.
What are the key properties of 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol?
2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol has a molecular weight of 357.29 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3-methoxyphenyl)-3-tert-butyl-4,4-dimethyloxolan-3-ol is sourced from PubChem (CID 12967236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).