C13H24IN — CID 12967359
(2R,6R)-1,1-dimethyl-2,6-bis(prop-2-enyl)piperidin-1-ium iodide (PubChem CID 12967359) has the molecular formula C13H24IN and a molecular weight of 321.25 g/mol. Its IUPAC name is (2R,6R)-1,1-dimethyl-2,6-bis(prop-2-enyl)piperidin-1-ium iodide.
| Compound Name | (2R,6R)-1,1-dimethyl-2,6-bis(prop-2-enyl)piperidin-1-ium iodide |
|---|---|
| PubChem CID | 12967359 |
| Molecular Formula | C13H24IN |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (2R,6R)-1,1-dimethyl-2,6-bis(prop-2-enyl)piperidin-1-ium iodide |
| SMILES | C=CC[C@H]1CCC[C@H](CC=C)[N+]1(C)C.[I-] |
| InChI | InChI=1S/C13H24N.HI/c1-5-8-12-10-7-11-13(9-6-2)14(12,3)4;/h5-6,12-13H,1-2,7-11H2,3-4H3;1H/q+1;/p-1/t12-,13-;/m0./s1 |
| InChIKey | DTRZPMZZELJTCN-QNTKWALQSA-M |
| XLogP | 0.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|