C20H17FN6O3S — CID 12967442
[4-amino-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-5-yl] cyclopropanesulfonate (PubChem CID 12967442) has the molecular formula C20H17FN6O3S and a molecular weight of 440.46 g/mol. Its IUPAC name is [4-amino-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-5-yl] cyclopropanesulfonate.
| Compound Name | [4-amino-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-5-yl] cyclopropanesulfonate |
|---|---|
| PubChem CID | 12967442 |
| Molecular Formula | C20H17FN6O3S |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [4-amino-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-5-yl] cyclopropanesulfonate |
| SMILES | Nc1nc(-c2nn(Cc3ccccc3F)c3ncccc23)ncc1OS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C20H17FN6O3S/c21-15-6-2-1-4-12(15)11-27-20-14(5-3-9-23-20)17(26-27)19-24-10-16(18(22)25-19)30-31(28,29)13-7-8-13/h1-6,9-10,13H,7-8,11H2,(H2,22,24,25) |
| InChIKey | FUFRDZPIMSWNAC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|