C21H23NO2 — CID 12968505
benzyl (1S,5S)-5-[[(1R)-1-phenylethyl]amino]cyclopent-2-ene-1-carboxylate (PubChem CID 12968505) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is benzyl (1S,5S)-5-[[(1R)-1-phenylethyl]amino]cyclopent-2-ene-1-carboxylate.
| Compound Name | benzyl (1S,5S)-5-[[(1R)-1-phenylethyl]amino]cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 12968505 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | benzyl (1S,5S)-5-[[(1R)-1-phenylethyl]amino]cyclopent-2-ene-1-carboxylate |
| SMILES | C[C@@H](N[C@H]1CC=C[C@@H]1C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-16(18-11-6-3-7-12-18)22-20-14-8-13-19(20)21(23)24-15-17-9-4-2-5-10-17/h2-13,16,19-20,22H,14-15H2,1H3/t16-,19+,20+/m1/s1 |
| InChIKey | KSUXMDSQVULXDN-UXPWSPDFSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|