About N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide
N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide (PubChem CID 12968561) has the molecular formula C25H37NO2Si
and a molecular weight of 411.66 g/mol. Its IUPAC name is N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide |
| PubChem CID | 12968561 |
| Molecular Formula | C25H37NO2Si |
| Molecular Weight | 411.66 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide |
| SMILES | CCCCNC(=O)C(O[Si](C)(C)C(C)(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H37NO2Si/c1-7-8-19-26-24(27)23(28-29(5,6)25(2,3)4)22(20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-18,22-23H,7-8,19H2,1-6H3,(H,26,27) |
| InChIKey | HMWBQCBYNYULOI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide?
The IUPAC name of N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide (CID 12968561) is N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide.
What is the SMILES notation for N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide?
The canonical SMILES for N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide is CCCCNC(=O)C(O[Si](C)(C)C(C)(C)C)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide?
The InChIKey is HMWBQCBYNYULOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H37NO2Si/c1-7-8-19-26-24(27)23(28-29(5,6)25(2,3)4)22(20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-18,22-23H,7-8,19H2,1-6H3,(H,26,27).
What are the key properties of N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide?
N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide has a molecular weight of 411.66 g/mol, XLogP of 6.13, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-[tert-butyl(dimethyl)silyl]oxy-3,3-diphenylpropanamide is sourced from PubChem (CID 12968561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).