C21H17FN2O6 — CID 1296864
Dimethyl 1-(4-fluorophenyl)-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 1296864) has the molecular formula C21H17FN2O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is dimethyl 1-(4-fluorophenyl)-4-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | Dimethyl 1-(4-fluorophenyl)-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 1296864 |
| Molecular Formula | C21H17FN2O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | dimethyl 1-(4-fluorophenyl)-4-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=CN(C=C(C1C2=CC=C(C=C2)[N+](=O)[O-])C(=O)OC)C3=CC=C(C=C3)F |
| InChI | InChI=1S/C21H17FN2O6/c1-29-20(25)17-11-23(15-9-5-14(22)6-10-15)12-18(21(26)30-2)19(17)13-3-7-16(8-4-13)24(27)28/h3-12,19H,1-2H3 |
| InChIKey | HBVIHLKCDKYCBE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | 696 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|