About n-Dodecyl nonaoxyethylene
n-Dodecyl nonaoxyethylene (PubChem CID 129694971) has the molecular formula C23H46O
and a molecular weight of 338.60 g/mol. Its IUPAC name is 2-nonoxytetradec-1-ene.
Molecular Properties
| Compound Name | n-Dodecyl nonaoxyethylene |
| PubChem CID | 129694971 |
| Molecular Formula | C23H46O |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 338.35 |
| IUPAC Name | 2-nonoxytetradec-1-ene |
| SMILES | CCCCCCCCCCCCC(=C)OCCCCCCCCC |
| InChI | InChI=1S/C23H46O/c1-4-6-8-10-12-13-14-15-17-19-21-23(3)24-22-20-18-16-11-9-7-5-2/h3-22H2,1-2H3 |
| InChIKey | YHGIKDGPTHMIDI-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | 246 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze n-Dodecyl nonaoxyethylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of n-Dodecyl nonaoxyethylene?
The IUPAC name of n-Dodecyl nonaoxyethylene (CID 129694971) is 2-nonoxytetradec-1-ene.
What is the SMILES notation for n-Dodecyl nonaoxyethylene?
The canonical SMILES for n-Dodecyl nonaoxyethylene is CCCCCCCCCCCCC(=C)OCCCCCCCCC.
What is the InChIKey of n-Dodecyl nonaoxyethylene?
The InChIKey is YHGIKDGPTHMIDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46O/c1-4-6-8-10-12-13-14-15-17-19-21-23(3)24-22-20-18-16-11-9-7-5-2/h3-22H2,1-2H3.
What are the key properties of n-Dodecyl nonaoxyethylene?
n-Dodecyl nonaoxyethylene has a molecular weight of 338.60 g/mol, XLogP of 10.80, 20 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for n-Dodecyl nonaoxyethylene is sourced from PubChem (CID 129694971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).