About 7-iodo-4-methoxy-2,3-dihydroinden-1-one
7-iodo-4-methoxy-2,3-dihydroinden-1-one (PubChem CID 12969786) has the molecular formula C10H9IO2
and a molecular weight of 288.08 g/mol. Its IUPAC name is 7-iodo-4-methoxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 7-iodo-4-methoxy-2,3-dihydroinden-1-one |
| PubChem CID | 12969786 |
| Molecular Formula | C10H9IO2 |
| Molecular Weight | 288.08 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 7-iodo-4-methoxy-2,3-dihydroinden-1-one |
| SMILES | COc1ccc(I)c2c1CCC2=O |
| InChI | InChI=1S/C10H9IO2/c1-13-9-5-3-7(11)10-6(9)2-4-8(10)12/h3,5H,2,4H2,1H3 |
| InChIKey | CCZSSZRPAXLBPM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.08 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-4-methoxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-4-methoxy-2,3-dihydroinden-1-one?
The IUPAC name of 7-iodo-4-methoxy-2,3-dihydroinden-1-one (CID 12969786) is 7-iodo-4-methoxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 7-iodo-4-methoxy-2,3-dihydroinden-1-one?
The canonical SMILES for 7-iodo-4-methoxy-2,3-dihydroinden-1-one is COc1ccc(I)c2c1CCC2=O.
What is the InChIKey of 7-iodo-4-methoxy-2,3-dihydroinden-1-one?
The InChIKey is CCZSSZRPAXLBPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IO2/c1-13-9-5-3-7(11)10-6(9)2-4-8(10)12/h3,5H,2,4H2,1H3.
What are the key properties of 7-iodo-4-methoxy-2,3-dihydroinden-1-one?
7-iodo-4-methoxy-2,3-dihydroinden-1-one has a molecular weight of 288.08 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-4-methoxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 12969786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).