C20H21NO2 — CID 12969925
2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,1-diphenylprop-2-en-1-ol (PubChem CID 12969925) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,1-diphenylprop-2-en-1-ol.
| Compound Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,1-diphenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 12969925 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,1-diphenylprop-2-en-1-ol |
| SMILES | C=C(C1=NC(C)(C)CO1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO2/c1-15(18-21-19(2,3)14-23-18)20(22,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,22H,1,14H2,2-3H3 |
| InChIKey | GCFLWZCDGPFXJH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |