About [(E)-7-oxohept-5-enyl] acetate
[(E)-7-oxohept-5-enyl] acetate (PubChem CID 12969936) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is [(E)-7-oxohept-5-enyl] acetate.
Molecular Properties
| Compound Name | [(E)-7-oxohept-5-enyl] acetate |
| PubChem CID | 12969936 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | [(E)-7-oxohept-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C/C=O |
| InChI | InChI=1S/C9H14O3/c1-9(11)12-8-6-4-2-3-5-7-10/h3,5,7H,2,4,6,8H2,1H3/b5-3+ |
| InChIKey | YCZFXCPTRUXLJS-HWKANZROSA-N |
| XLogP | 1.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-7-oxohept-5-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-7-oxohept-5-enyl] acetate?
The IUPAC name of [(E)-7-oxohept-5-enyl] acetate (CID 12969936) is [(E)-7-oxohept-5-enyl] acetate.
What is the SMILES notation for [(E)-7-oxohept-5-enyl] acetate?
The canonical SMILES for [(E)-7-oxohept-5-enyl] acetate is CC(=O)OCCCC/C=C/C=O.
What is the InChIKey of [(E)-7-oxohept-5-enyl] acetate?
The InChIKey is YCZFXCPTRUXLJS-HWKANZROSA-N. The full InChI is InChI=1S/C9H14O3/c1-9(11)12-8-6-4-2-3-5-7-10/h3,5,7H,2,4,6,8H2,1H3/b5-3+.
What are the key properties of [(E)-7-oxohept-5-enyl] acetate?
[(E)-7-oxohept-5-enyl] acetate has a molecular weight of 170.21 g/mol, XLogP of 1.47, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-7-oxohept-5-enyl] acetate is sourced from PubChem (CID 12969936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).