About [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate (PubChem CID 12971689) has the molecular formula C22H35NO2
and a molecular weight of 345.53 g/mol. Its IUPAC name is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate.
Molecular Properties
| Compound Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate |
| PubChem CID | 12971689 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate |
| SMILES | CC(C)CCCC(=O)OC1CCC(c2ccc(CN(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H35NO2/c1-17(2)6-5-7-22(24)25-21-14-12-20(13-15-21)19-10-8-18(9-11-19)16-23(3)4/h8-11,17,20-21H,5-7,12-16H2,1-4H3 |
| InChIKey | WHVIPRYHYMEVRA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate?
The IUPAC name of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate (CID 12971689) is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate.
What is the SMILES notation for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate?
The canonical SMILES for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate is CC(C)CCCC(=O)OC1CCC(c2ccc(CN(C)C)cc2)CC1.
What is the InChIKey of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate?
The InChIKey is WHVIPRYHYMEVRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO2/c1-17(2)6-5-7-22(24)25-21-14-12-20(13-15-21)19-10-8-18(9-11-19)16-23(3)4/h8-11,17,20-21H,5-7,12-16H2,1-4H3.
What are the key properties of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate?
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate has a molecular weight of 345.53 g/mol, XLogP of 5.14, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 5-methylhexanoate is sourced from PubChem (CID 12971689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).