About [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate (PubChem CID 12971690) has the molecular formula C23H35NO2
and a molecular weight of 357.54 g/mol. Its IUPAC name is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate.
Molecular Properties
| Compound Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate |
| PubChem CID | 12971690 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate |
| SMILES | CN(C)Cc1ccc(C2CCC(OC(=O)CC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H35NO2/c1-24(2)17-19-8-10-20(11-9-19)21-12-14-22(15-13-21)26-23(25)16-18-6-4-3-5-7-18/h8-11,18,21-22H,3-7,12-17H2,1-2H3 |
| InChIKey | DWLPJHACZKCBKX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate?
The IUPAC name of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate (CID 12971690) is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate.
What is the SMILES notation for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate?
The canonical SMILES for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate is CN(C)Cc1ccc(C2CCC(OC(=O)CC3CCCCC3)CC2)cc1.
What is the InChIKey of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate?
The InChIKey is DWLPJHACZKCBKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35NO2/c1-24(2)17-19-8-10-20(11-9-19)21-12-14-22(15-13-21)26-23(25)16-18-6-4-3-5-7-18/h8-11,18,21-22H,3-7,12-17H2,1-2H3.
What are the key properties of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate?
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate has a molecular weight of 357.54 g/mol, XLogP of 5.29, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-cyclohexylacetate is sourced from PubChem (CID 12971690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).