About 3-Vinyltoluene oxide
3-Vinyltoluene oxide (PubChem CID 129717860) has the molecular formula C9H10O
and a molecular weight of 134.17 g/mol. Its IUPAC name is 5-ethenyl-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene.
Molecular Properties
| Compound Name | 3-Vinyltoluene oxide |
| PubChem CID | 129717860 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.17 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 5-ethenyl-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC12C=CC=C(C1O2)C=C |
| InChI | InChI=1S/C9H10O/c1-3-7-5-4-6-9(2)8(7)10-9/h3-6,8H,1H2,2H3 |
| InChIKey | ZOYDCTPYLOGOLV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 237 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-Vinyltoluene oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Vinyltoluene oxide?
The IUPAC name of 3-Vinyltoluene oxide (CID 129717860) is 5-ethenyl-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for 3-Vinyltoluene oxide?
The canonical SMILES for 3-Vinyltoluene oxide is CC12C=CC=C(C1O2)C=C.
What is the InChIKey of 3-Vinyltoluene oxide?
The InChIKey is ZOYDCTPYLOGOLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-3-7-5-4-6-9(2)8(7)10-9/h3-6,8H,1H2,2H3.
What are the key properties of 3-Vinyltoluene oxide?
3-Vinyltoluene oxide has a molecular weight of 134.17 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Vinyltoluene oxide is sourced from PubChem (CID 129717860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).