C13H22O3 — CID 12971957
(Z)-3-methyl-5-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)pent-2-enal (PubChem CID 12971957) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (Z)-3-methyl-5-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)pent-2-enal.
| Compound Name | (Z)-3-methyl-5-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)pent-2-enal |
|---|---|
| PubChem CID | 12971957 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (Z)-3-methyl-5-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)pent-2-enal |
| SMILES | C/C(=C/C=O)CCC1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H22O3/c1-10(8-9-14)6-7-11-12(2,3)16-13(4,5)15-11/h8-9,11H,6-7H2,1-5H3/b10-8- |
| InChIKey | IWZUSGSTZFIVHW-NTMALXAHSA-N |
| XLogP | 2.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|