C16H29NO3Si — CID 12972862
tert-butyl (2S,3R)-1-[tert-butyl(dimethyl)silyl]-3-ethenyl-4-oxoazetidine-2-carboxylate (PubChem CID 12972862) has the molecular formula C16H29NO3Si and a molecular weight of 311.50 g/mol. Its IUPAC name is tert-butyl (2S,3R)-1-[tert-butyl(dimethyl)silyl]-3-ethenyl-4-oxoazetidine-2-carboxylate.
| Compound Name | tert-butyl (2S,3R)-1-[tert-butyl(dimethyl)silyl]-3-ethenyl-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 12972862 |
| Molecular Formula | C16H29NO3Si |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | tert-butyl (2S,3R)-1-[tert-butyl(dimethyl)silyl]-3-ethenyl-4-oxoazetidine-2-carboxylate |
| SMILES | C=C[C@H]1C(=O)N([Si](C)(C)C(C)(C)C)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO3Si/c1-10-11-12(14(19)20-15(2,3)4)17(13(11)18)21(8,9)16(5,6)7/h10-12H,1H2,2-9H3/t11-,12+/m1/s1 |
| InChIKey | AAZNHZUMTZQNQQ-NEPJUHHUSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|