About dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate
dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 1297295) has the molecular formula C23H22N2O7
and a molecular weight of 438.44 g/mol. Its IUPAC name is dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| PubChem CID | 1297295 |
| Molecular Formula | C23H22N2O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=CN(c2ccc(OC)cc2)C=C(C(=O)OC)C1c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22N2O7/c1-14-5-6-15(11-20(14)25(28)29)21-18(22(26)31-3)12-24(13-19(21)23(27)32-4)16-7-9-17(30-2)10-8-16/h5-13,21H,1-4H3 |
| InChIKey | CQWFJACPUQVVQZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (CID 1297295) is dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate is COC(=O)C1=CN(c2ccc(OC)cc2)C=C(C(=O)OC)C1c1ccc(C)c([N+](=O)[O-])c1.
What is the InChIKey of dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate?
The InChIKey is CQWFJACPUQVVQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O7/c1-14-5-6-15(11-20(14)25(28)29)21-18(22(26)31-3)12-24(13-19(21)23(27)32-4)16-7-9-17(30-2)10-8-16/h5-13,21H,1-4H3.
What are the key properties of dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate?
dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate has a molecular weight of 438.44 g/mol, XLogP of 3.63, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-(4-methoxyphenyl)-4-(4-methyl-3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 1297295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).