C9H14N2 — CID 12973048
4,5,6,7-tetrahydro-2H-isoindol-5-ylmethanamine (PubChem CID 12973048) has the molecular formula C9H14N2 and a molecular weight of 150.23 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-2H-isoindol-5-ylmethanamine.
| Compound Name | 4,5,6,7-tetrahydro-2H-isoindol-5-ylmethanamine |
|---|---|
| PubChem CID | 12973048 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 4,5,6,7-tetrahydro-2H-isoindol-5-ylmethanamine |
| SMILES | NCC1CCc2c[nH]cc2C1 |
| InChI | InChI=1S/C9H14N2/c10-4-7-1-2-8-5-11-6-9(8)3-7/h5-7,11H,1-4,10H2 |
| InChIKey | AHQVWVILFQJKSM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |