C11H17N5OS — CID 12973050
N-[[2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]methyl]acetamide (PubChem CID 12973050) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is N-[[2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]methyl]acetamide.
| Compound Name | N-[[2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]methyl]acetamide |
|---|---|
| PubChem CID | 12973050 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[[2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCc2nc(N=C(N)N)sc2C1 |
| InChI | InChI=1S/C11H17N5OS/c1-6(17)14-5-7-2-3-8-9(4-7)18-11(15-8)16-10(12)13/h7H,2-5H2,1H3,(H,14,17)(H4,12,13,15,16) |
| InChIKey | OYDVACUZLCNVEJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|