C22H38B2Cl2N2S — CID 12973671
chloro-[5-[chloro-(2,2,6,6-tetramethylpiperidin-1-yl)boranyl]thiophen-2-yl]-(2,2,6,6-tetramethylpiperidin-1-yl)borane (PubChem CID 12973671) has the molecular formula C22H38B2Cl2N2S and a molecular weight of 455.16 g/mol. Its IUPAC name is chloro-[5-[chloro-(2,2,6,6-tetramethylpiperidin-1-yl)boranyl]thiophen-2-yl]-(2,2,6,6-tetramethylpiperidin-1-yl)borane.
| Compound Name | chloro-[5-[chloro-(2,2,6,6-tetramethylpiperidin-1-yl)boranyl]thiophen-2-yl]-(2,2,6,6-tetramethylpiperidin-1-yl)borane |
|---|---|
| PubChem CID | 12973671 |
| Molecular Formula | C22H38B2Cl2N2S |
| Molecular Weight | 455.16 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | chloro-[5-[chloro-(2,2,6,6-tetramethylpiperidin-1-yl)boranyl]thiophen-2-yl]-(2,2,6,6-tetramethylpiperidin-1-yl)borane |
| SMILES | CC1(C)CCCC(C)(C)N1B(Cl)c1ccc(B(Cl)N2C(C)(C)CCCC2(C)C)s1 |
| InChI | InChI=1S/C22H38B2Cl2N2S/c1-19(2)13-9-14-20(3,4)27(19)23(25)17-11-12-18(29-17)24(26)28-21(5,6)15-10-16-22(28,7)8/h11-12H,9-10,13-16H2,1-8H3 |
| InChIKey | DCODMCUBFYRBJZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.16 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|