C20H22F3N3O2 — CID 1297371
4-(2-ethoxyphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 1297371) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-ethoxyphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 1297371 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 4-(2-ethoxyphenyl)-N-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CCOc1ccccc1N1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-2-28-18-10-6-5-9-17(18)25-11-13-26(14-12-25)19(27)24-16-8-4-3-7-15(16)20(21,22)23/h3-10H,2,11-14H2,1H3,(H,24,27) |
| InChIKey | RERHRYYCSYYUPD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |