C15H26N4 — CID 12973962
2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]aniline (PubChem CID 12973962) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]aniline.
| Compound Name | 2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 12973962 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]aniline |
| SMILES | CN1CCN(C)CCN(Cc2ccccc2N)CC1 |
| InChI | InChI=1S/C15H26N4/c1-17-7-8-18(2)10-12-19(11-9-17)13-14-5-3-4-6-15(14)16/h3-6H,7-13,16H2,1-2H3 |
| InChIKey | URBGKXKFMGEVDC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|