C10H8N4 — CID 12974835
3-methylcyclopentane-1,1,2,2-tetracarbonitrile (PubChem CID 12974835) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-methylcyclopentane-1,1,2,2-tetracarbonitrile.
| Compound Name | 3-methylcyclopentane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 12974835 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-methylcyclopentane-1,1,2,2-tetracarbonitrile |
| SMILES | CC1CCC(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C10H8N4/c1-8-2-3-9(4-11,5-12)10(8,6-13)7-14/h8H,2-3H2,1H3 |
| InChIKey | MXYDWDCNOJXXRH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|