About N-trifluoroacetyl-l-valyl-l-threonine methyl ester
N-trifluoroacetyl-l-valyl-l-threonine methyl ester (PubChem CID 129756358) has the molecular formula C12H19F3N2O5
and a molecular weight of 328.28 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-[[(2S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]butanoate.
Molecular Properties
| Compound Name | N-trifluoroacetyl-l-valyl-l-threonine methyl ester |
| PubChem CID | 129756358 |
| Molecular Formula | C12H19F3N2O5 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-2-[[(2S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]butanoate |
| SMILES | C[C@H]([C@@H](C(=O)OC)NC(=O)[C@H](C(C)C)NC(=O)C(F)(F)F)O |
| InChI | InChI=1S/C12H19F3N2O5/c1-5(2)7(17-11(21)12(13,14)15)9(19)16-8(6(3)18)10(20)22-4/h5-8,18H,1-4H3,(H,16,19)(H,17,21)/t6-,7+,8+/m1/s1 |
| InChIKey | KOEMFXVSLSQTCU-CSMHCCOUSA-N |
| XLogP | 0.80 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | 425 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-trifluoroacetyl-l-valyl-l-threonine methyl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-trifluoroacetyl-l-valyl-l-threonine methyl ester?
The IUPAC name of N-trifluoroacetyl-l-valyl-l-threonine methyl ester (CID 129756358) is methyl (2S,3R)-3-hydroxy-2-[[(2S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]butanoate.
What is the SMILES notation for N-trifluoroacetyl-l-valyl-l-threonine methyl ester?
The canonical SMILES for N-trifluoroacetyl-l-valyl-l-threonine methyl ester is C[C@H]([C@@H](C(=O)OC)NC(=O)[C@H](C(C)C)NC(=O)C(F)(F)F)O.
What is the InChIKey of N-trifluoroacetyl-l-valyl-l-threonine methyl ester?
The InChIKey is KOEMFXVSLSQTCU-CSMHCCOUSA-N. The full InChI is InChI=1S/C12H19F3N2O5/c1-5(2)7(17-11(21)12(13,14)15)9(19)16-8(6(3)18)10(20)22-4/h5-8,18H,1-4H3,(H,16,19)(H,17,21)/t6-,7+,8+/m1/s1.
What are the key properties of N-trifluoroacetyl-l-valyl-l-threonine methyl ester?
N-trifluoroacetyl-l-valyl-l-threonine methyl ester has a molecular weight of 328.28 g/mol, XLogP of 0.80, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-trifluoroacetyl-l-valyl-l-threonine methyl ester is sourced from PubChem (CID 129756358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).