About 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine
2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine (PubChem CID 12975816) has the molecular formula C17H21N5
and a molecular weight of 295.39 g/mol. Its IUPAC name is 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine.
Molecular Properties
| Compound Name | 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
| PubChem CID | 12975816 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
| SMILES | Cc1cc(C)n(Cc2cccc(Cn3nc(C)cc3C)n2)n1 |
| InChI | InChI=1S/C17H21N5/c1-12-8-14(3)21(19-12)10-16-6-5-7-17(18-16)11-22-15(4)9-13(2)20-22/h5-9H,10-11H2,1-4H3 |
| InChIKey | PZROUOOSVHHWDV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine?
The IUPAC name of 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine (CID 12975816) is 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine.
What is the SMILES notation for 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine?
The canonical SMILES for 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine is Cc1cc(C)n(Cc2cccc(Cn3nc(C)cc3C)n2)n1.
What is the InChIKey of 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine?
The InChIKey is PZROUOOSVHHWDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5/c1-12-8-14(3)21(19-12)10-16-6-5-7-17(18-16)11-22-15(4)9-13(2)20-22/h5-9H,10-11H2,1-4H3.
What are the key properties of 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine?
2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine has a molecular weight of 295.39 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine is sourced from PubChem (CID 12975816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).