C17H30 — CID 12976520
1,2,5-tritert-butylcyclopenta-1,3-diene (PubChem CID 12976520) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 1,2,5-tritert-butylcyclopenta-1,3-diene.
| Compound Name | 1,2,5-tritert-butylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 12976520 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 1,2,5-tritert-butylcyclopenta-1,3-diene |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C17H30/c1-15(2,3)12-10-11-13(16(4,5)6)14(12)17(7,8)9/h10-12H,1-9H3 |
| InChIKey | BDAGSOVVHVHRAC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |