About 1,1,3-Tri-methyldisiloxane
1,1,3-Tri-methyldisiloxane (PubChem CID 12976756) has the molecular formula C3H9OSi2
and a molecular weight of 117.28 g/mol.
Molecular Properties
| Compound Name | 1,1,3-Tri-methyldisiloxane |
| PubChem CID | 12976756 |
| Molecular Formula | C3H9OSi2 |
| Molecular Weight | 117.28 g/mol |
| Exact Mass | 117.02 |
| IUPAC Name | — |
| SMILES | C[Si]O[Si](C)C |
| InChI | InChI=1S/C3H9OSi2/c1-5-4-6(2)3/h1-3H3 |
| InChIKey | MJHFBYSAHRDDND-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3-Tri-methyldisiloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-Tri-methyldisiloxane?
The IUPAC name of 1,1,3-Tri-methyldisiloxane (CID 12976756) is not available.
What is the SMILES notation for 1,1,3-Tri-methyldisiloxane?
The canonical SMILES for 1,1,3-Tri-methyldisiloxane is C[Si]O[Si](C)C.
What is the InChIKey of 1,1,3-Tri-methyldisiloxane?
The InChIKey is MJHFBYSAHRDDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9OSi2/c1-5-4-6(2)3/h1-3H3.
What are the key properties of 1,1,3-Tri-methyldisiloxane?
1,1,3-Tri-methyldisiloxane has a molecular weight of 117.28 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-Tri-methyldisiloxane is sourced from PubChem (CID 12976756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).