About 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane
2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane (PubChem CID 12977114) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane.
Molecular Properties
| Compound Name | 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane |
| PubChem CID | 12977114 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane |
| SMILES | C1=CC(CC2CCCO2)C=C1 |
| InChI | InChI=1S/C10H14O/c1-2-5-9(4-1)8-10-6-3-7-11-10/h1-2,4-5,9-10H,3,6-8H2 |
| InChIKey | YMRYKQMRXTXGAB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane?
The IUPAC name of 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane (CID 12977114) is 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane.
What is the SMILES notation for 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane?
The canonical SMILES for 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane is C1=CC(CC2CCCO2)C=C1.
What is the InChIKey of 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane?
The InChIKey is YMRYKQMRXTXGAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-2-5-9(4-1)8-10-6-3-7-11-10/h1-2,4-5,9-10H,3,6-8H2.
What are the key properties of 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane?
2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane has a molecular weight of 150.22 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopenta-2,4-dien-1-ylmethyl)oxolane is sourced from PubChem (CID 12977114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).