About 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide
4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide (PubChem CID 12977207) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide.
Molecular Properties
| Compound Name | 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide |
| PubChem CID | 12977207 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide |
| SMILES | CC(CCC(=O)N(C)C)=C1C=CC=C1 |
| InChI | InChI=1S/C12H17NO/c1-10(11-6-4-5-7-11)8-9-12(14)13(2)3/h4-7H,8-9H2,1-3H3 |
| InChIKey | FTLYUWQPNYNKMF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide?
The IUPAC name of 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide (CID 12977207) is 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide.
What is the SMILES notation for 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide?
The canonical SMILES for 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide is CC(CCC(=O)N(C)C)=C1C=CC=C1.
What is the InChIKey of 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide?
The InChIKey is FTLYUWQPNYNKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-10(11-6-4-5-7-11)8-9-12(14)13(2)3/h4-7H,8-9H2,1-3H3.
What are the key properties of 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide?
4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide has a molecular weight of 191.27 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylpentanamide is sourced from PubChem (CID 12977207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).