C18H26Cl2Zr — CID 12977416
dichlorozirconium(2+);bis(1,2,3,5-tetramethylcyclopenta-1,3-diene) (PubChem CID 12977416) has the molecular formula C18H26Cl2Zr and a molecular weight of 404.54 g/mol. Its IUPAC name is dichlorozirconium(2+);bis(1,2,3,5-tetramethylcyclopenta-1,3-diene).
| Compound Name | dichlorozirconium(2+);bis(1,2,3,5-tetramethylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 12977416 |
| Molecular Formula | C18H26Cl2Zr |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | dichlorozirconium(2+);bis(1,2,3,5-tetramethylcyclopenta-1,3-diene) |
| SMILES | Cc1c[c-](C)c(C)c1C.Cc1c[c-](C)c(C)c1C.Cl[Zr+2]Cl |
| InChI | InChI=1S/2C9H13.2ClH.Zr/c2*1-6-5-7(2)9(4)8(6)3;;;/h2*5H,1-4H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | MAALGNWGAOOGNY-UHFFFAOYSA-L |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|