About 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid
2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid (PubChem CID 1297783) has the molecular formula C22H16N2O4S
and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid |
| PubChem CID | 1297783 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid |
| SMILES | COc1ccc2nc(NC(=O)c3ccccc3-c3ccccc3C(=O)O)sc2c1 |
| InChI | InChI=1S/C22H16N2O4S/c1-28-13-10-11-18-19(12-13)29-22(23-18)24-20(25)16-8-4-2-6-14(16)15-7-3-5-9-17(15)21(26)27/h2-12H,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | PLMXHBWSPZPZJA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid?
The IUPAC name of 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid (CID 1297783) is 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid.
What is the SMILES notation for 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid?
The canonical SMILES for 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid is COc1ccc2nc(NC(=O)c3ccccc3-c3ccccc3C(=O)O)sc2c1.
What is the InChIKey of 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid?
The InChIKey is PLMXHBWSPZPZJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O4S/c1-28-13-10-11-18-19(12-13)29-22(23-18)24-20(25)16-8-4-2-6-14(16)15-7-3-5-9-17(15)21(26)27/h2-12H,1H3,(H,26,27)(H,23,24,25).
What are the key properties of 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid?
2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid has a molecular weight of 404.45 g/mol, XLogP of 4.92, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]benzoic acid is sourced from PubChem (CID 1297783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).