About 4-(thian-2-yloxy)phenol
4-(thian-2-yloxy)phenol (PubChem CID 12978203) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 4-(thian-2-yloxy)phenol.
Molecular Properties
| Compound Name | 4-(thian-2-yloxy)phenol |
| PubChem CID | 12978203 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 4-(thian-2-yloxy)phenol |
| SMILES | Oc1ccc(OC2CCCCS2)cc1 |
| InChI | InChI=1S/C11H14O2S/c12-9-4-6-10(7-5-9)13-11-3-1-2-8-14-11/h4-7,11-12H,1-3,8H2 |
| InChIKey | HJRGXHLPICBGPA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(thian-2-yloxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(thian-2-yloxy)phenol?
The IUPAC name of 4-(thian-2-yloxy)phenol (CID 12978203) is 4-(thian-2-yloxy)phenol.
What is the SMILES notation for 4-(thian-2-yloxy)phenol?
The canonical SMILES for 4-(thian-2-yloxy)phenol is Oc1ccc(OC2CCCCS2)cc1.
What is the InChIKey of 4-(thian-2-yloxy)phenol?
The InChIKey is HJRGXHLPICBGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c12-9-4-6-10(7-5-9)13-11-3-1-2-8-14-11/h4-7,11-12H,1-3,8H2.
What are the key properties of 4-(thian-2-yloxy)phenol?
4-(thian-2-yloxy)phenol has a molecular weight of 210.30 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(thian-2-yloxy)phenol is sourced from PubChem (CID 12978203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).