About 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one
1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one (PubChem CID 129791065) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 1,2,9-trimethylpyrrolo[3,2-f]quinolin-7-one.
Molecular Properties
| Compound Name | 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one |
| PubChem CID | 129791065 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1,2,9-trimethylpyrrolo[3,2-f]quinolin-7-one |
| SMILES | CC1=CC(=O)N=C2C1=C3C(=C(N=C3C=C2)C)C |
| InChI | InChI=1S/C14H12N2O/c1-7-6-12(17)16-10-4-5-11-14(13(7)10)8(2)9(3)15-11/h4-6H,1-3H3 |
| InChIKey | ZHFFJZHDDQWHER-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | 637 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one?
The IUPAC name of 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one (CID 129791065) is 1,2,9-trimethylpyrrolo[3,2-f]quinolin-7-one.
What is the SMILES notation for 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one?
The canonical SMILES for 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one is CC1=CC(=O)N=C2C1=C3C(=C(N=C3C=C2)C)C.
What is the InChIKey of 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one?
The InChIKey is ZHFFJZHDDQWHER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c1-7-6-12(17)16-10-4-5-11-14(13(7)10)8(2)9(3)15-11/h4-6H,1-3H3.
What are the key properties of 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one?
1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one has a molecular weight of 224.26 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,9-Trimethyl-pyrrolo[3,2-f]quinol-7-one is sourced from PubChem (CID 129791065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).